C24H45N2O3P — CID 58919153
1-[(3R,4S)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3-ethylcyclohexyl]heptan-1-one (PubChem CID 58919153) has the molecular formula C24H45N2O3P and a molecular weight of 440.61 g/mol. Its IUPAC name is 1-[(3R,4S)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3-ethylcyclohexyl]heptan-1-one.
| Compound Name | 1-[(3R,4S)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3-ethylcyclohexyl]heptan-1-one |
|---|---|
| PubChem CID | 58919153 |
| Molecular Formula | C24H45N2O3P |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.32 |
| IUPAC Name | 1-[(3R,4S)-4-[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxy-3-ethylcyclohexyl]heptan-1-one |
| SMILES | [C-]#[N+]CCOP(O[C@H]1CCC(C(=O)CCCCCC)C[C@H]1CC)N(C(C)C)C(C)C |
| InChI | InChI=1S/C24H45N2O3P/c1-8-10-11-12-13-23(27)22-14-15-24(21(9-2)18-22)29-30(28-17-16-25-7)26(19(3)4)20(5)6/h19-22,24H,8-18H2,1-6H3/t21-,22?,24+,30?/m1/s1 |
| InChIKey | NRSKYQOTZDXVRV-BEPCKZEGSA-N |
| XLogP | 7.02 |
| TPSA | 43.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|