C38H66BN2O7PSi — CID 158075225
CID 158075225 (PubChem CID 158075225) has the molecular formula C38H66BN2O7PSi and a molecular weight of 732.83 g/mol.
| Compound Name | CID 158075225 |
|---|---|
| PubChem CID | 158075225 |
| Molecular Formula | C38H66BN2O7PSi |
| Molecular Weight | 732.83 g/mol |
| Exact Mass | 732.45 |
| IUPAC Name | — |
| SMILES | [B][C@H]1CC(OP(OCC[N+]#[C-])N(C(C)C)C(C)C)[C@@H](CO[Si](OCCCCCCCC(=O)OCC2[C@H]3CCC#CCC[C@@H]23)(C(C)C)C(C)C)O1 |
| InChI | InChI=1S/C38H66BN2O7PSi/c1-28(2)41(29(3)4)49(44-24-22-40-9)48-35-25-37(39)47-36(35)27-46-50(30(5)6,31(7)8)45-23-18-14-10-11-17-21-38(42)43-26-34-32-19-15-12-13-16-20-33(32)34/h28-37H,10-11,14-27H2,1-8H3/t32-,33+,34?,35?,36-,37-,49?/m1/s1 |
| InChIKey | XNVSQTZEHDQFLG-HFCWVCQZSA-N |
| XLogP | 8.56 |
| TPSA | 80.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.83 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|