C20H36N2O3P2 — CID 165069612
N-[[2-[(E)-2-dimethylphosphorylethenyl]-5-methylcyclohex-3-en-1-yl]oxy-(2-isocyanoethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine (PubChem CID 165069612) has the molecular formula C20H36N2O3P2 and a molecular weight of 414.47 g/mol. Its IUPAC name is N-[[2-[(E)-2-dimethylphosphorylethenyl]-5-methylcyclohex-3-en-1-yl]oxy-(2-isocyanoethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine.
| Compound Name | N-[[2-[(E)-2-dimethylphosphorylethenyl]-5-methylcyclohex-3-en-1-yl]oxy-(2-isocyanoethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 165069612 |
| Molecular Formula | C20H36N2O3P2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | N-[[2-[(E)-2-dimethylphosphorylethenyl]-5-methylcyclohex-3-en-1-yl]oxy-(2-isocyanoethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine |
| SMILES | [C-]#[N+]CCOP(OC1CC(C)C=CC1/C=C/P(C)(C)=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C20H36N2O3P2/c1-16(2)22(17(3)4)26(24-13-12-21-6)25-20-15-18(5)9-10-19(20)11-14-27(7,8)23/h9-11,14,16-20H,12-13,15H2,1-5,7-8H3/b14-11+ |
| InChIKey | GTAIBVWOCPHFTP-SDNWHVSQSA-N |
| XLogP | 6.00 |
| TPSA | 43.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|