C17H36N3O3P — CID 158424911
(2S,5S)-2-[[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxymethyl]-N,5-dimethyloxolan-3-amine;methane (PubChem CID 158424911) has the molecular formula C17H36N3O3P and a molecular weight of 361.47 g/mol. Its IUPAC name is (2S,5S)-2-[[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxymethyl]-N,5-dimethyloxolan-3-amine;methane.
| Compound Name | (2S,5S)-2-[[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxymethyl]-N,5-dimethyloxolan-3-amine;methane |
|---|---|
| PubChem CID | 158424911 |
| Molecular Formula | C17H36N3O3P |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | (2S,5S)-2-[[[di(propan-2-yl)amino]-(2-isocyanoethoxy)phosphanyl]oxymethyl]-N,5-dimethyloxolan-3-amine;methane |
| SMILES | C.[C-]#[N+]CCOP(OC[C@H]1O[C@@H](C)CC1NC)N(C(C)C)C(C)C |
| InChI | InChI=1S/C16H32N3O3P.CH4/c1-12(2)19(13(3)4)23(20-9-8-17-6)21-11-16-15(18-7)10-14(5)22-16;/h12-16,18H,8-11H2,1-5,7H3;1H4/t14-,15?,16+,23?;/m0./s1 |
| InChIKey | HAXVQWPXRHLXNB-HJVDUTQGSA-N |
| XLogP | 3.69 |
| TPSA | 47.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|