C14H27N2O3P — CID 140773073
N-[[(2R,3S,5S)-2-(deuteriomethyl)-5-tritiooxolan-3-yl]oxy-(2-isocyanoethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine (PubChem CID 140773073) has the molecular formula C14H27N2O3P and a molecular weight of 305.37 g/mol. Its IUPAC name is N-[[(2R,3S,5S)-2-(deuteriomethyl)-5-tritiooxolan-3-yl]oxy-(2-isocyanoethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine.
| Compound Name | N-[[(2R,3S,5S)-2-(deuteriomethyl)-5-tritiooxolan-3-yl]oxy-(2-isocyanoethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 140773073 |
| Molecular Formula | C14H27N2O3P |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | N-[[(2R,3S,5S)-2-(deuteriomethyl)-5-tritiooxolan-3-yl]oxy-(2-isocyanoethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine |
| SMILES | [2H]C[C@H]1O[C@@H]([3H])C[C@@H]1OP(OCC[N+]#[C-])N(C(C)C)C(C)C |
| InChI | InChI=1S/C14H27N2O3P/c1-11(2)16(12(3)4)20(18-10-8-15-6)19-14-7-9-17-13(14)5/h11-14H,7-10H2,1-5H3/t13-,14+,20?/m1/s1/i5D,9T/t9-,13+,14-,20?/m0 |
| InChIKey | OBUKGGPRRVSZMH-XLYOXGGGSA-N |
| XLogP | 3.46 |
| TPSA | 35.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|