C17H29BrNO5P — CID 160962088
[4-bromo-1-[(2S,3S,5R)-3-methyl-5-tritiooxolan-2-yl]butyl] [(2R,3S,5R)-2-(deuteriomethyl)-5-tritiooxolan-3-yl] 2-isocyanoethyl phosphite (PubChem CID 160962088) has the molecular formula C17H29BrNO5P and a molecular weight of 443.32 g/mol. Its IUPAC name is [4-bromo-1-[(2S,3S,5R)-3-methyl-5-tritiooxolan-2-yl]butyl] [(2R,3S,5R)-2-(deuteriomethyl)-5-tritiooxolan-3-yl] 2-isocyanoethyl phosphite.
| Compound Name | [4-bromo-1-[(2S,3S,5R)-3-methyl-5-tritiooxolan-2-yl]butyl] [(2R,3S,5R)-2-(deuteriomethyl)-5-tritiooxolan-3-yl] 2-isocyanoethyl phosphite |
|---|---|
| PubChem CID | 160962088 |
| Molecular Formula | C17H29BrNO5P |
| Molecular Weight | 443.32 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | [4-bromo-1-[(2S,3S,5R)-3-methyl-5-tritiooxolan-2-yl]butyl] [(2R,3S,5R)-2-(deuteriomethyl)-5-tritiooxolan-3-yl] 2-isocyanoethyl phosphite |
| SMILES | [2H]C[C@H]1O[C@H]([3H])C[C@@H]1OP(OCC[N+]#[C-])OC(CCCBr)[C@H]1O[C@H]([3H])C[C@@H]1C |
| InChI | InChI=1S/C17H29BrNO5P/c1-13-6-10-21-17(13)16(5-4-8-18)24-25(22-12-9-19-3)23-15-7-11-20-14(15)2/h13-17H,4-12H2,1-2H3/t13-,14+,15-,16?,17-,25?/m0/s1/i2D,10T,11T/t10-,11-,13+,14-,15+,16?,17+,25?/m1 |
| InChIKey | PSXJLAWOSUKSOK-ZGJFRINCSA-N |
| XLogP | 4.33 |
| TPSA | 50.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.32 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|