C34H44N3O3P — CID 118528891
3-[[di(propan-2-yl)amino]-[[(2S,5S)-5-methyl-3-(tritylamino)oxolan-2-yl]methoxy]phosphanyl]oxypropanenitrile (PubChem CID 118528891) has the molecular formula C34H44N3O3P and a molecular weight of 573.72 g/mol. Its IUPAC name is 3-[[di(propan-2-yl)amino]-[[(2S,5S)-5-methyl-3-(tritylamino)oxolan-2-yl]methoxy]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[di(propan-2-yl)amino]-[[(2S,5S)-5-methyl-3-(tritylamino)oxolan-2-yl]methoxy]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 118528891 |
| Molecular Formula | C34H44N3O3P |
| Molecular Weight | 573.72 g/mol |
| Exact Mass | 573.31 |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-[[(2S,5S)-5-methyl-3-(tritylamino)oxolan-2-yl]methoxy]phosphanyl]oxypropanenitrile |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OC[C@H]1O[C@@H](C)CC1NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H44N3O3P/c1-26(2)37(27(3)4)41(38-23-15-22-35)39-25-33-32(24-28(5)40-33)36-34(29-16-9-6-10-17-29,30-18-11-7-12-19-30)31-20-13-8-14-21-31/h6-14,16-21,26-28,32-33,36H,15,23-25H2,1-5H3/t28-,32?,33+,41?/m0/s1 |
| InChIKey | BQORXXLQDDDWPX-MICSPOSCSA-N |
| XLogP | 7.41 |
| TPSA | 66.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.72 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|