C41H51N9O3P+ — CID 144955117
[2-cyanoethoxy-[[5-[6-[(Z)-dimethylaminomethylideneamino]purin-9-yl]-3-(tritylamino)oxolan-2-yl]methoxy]phosphanyl]-di(propan-2-yl)azanium (PubChem CID 144955117) has the molecular formula C41H51N9O3P+ and a molecular weight of 748.89 g/mol. Its IUPAC name is [2-cyanoethoxy-[[5-[6-[(Z)-dimethylaminomethylideneamino]purin-9-yl]-3-(tritylamino)oxolan-2-yl]methoxy]phosphanyl]-di(propan-2-yl)azanium.
| Compound Name | [2-cyanoethoxy-[[5-[6-[(Z)-dimethylaminomethylideneamino]purin-9-yl]-3-(tritylamino)oxolan-2-yl]methoxy]phosphanyl]-di(propan-2-yl)azanium |
|---|---|
| PubChem CID | 144955117 |
| Molecular Formula | C41H51N9O3P+ |
| Molecular Weight | 748.89 g/mol |
| Exact Mass | 748.38 |
| IUPAC Name | [2-cyanoethoxy-[[5-[6-[(Z)-dimethylaminomethylideneamino]purin-9-yl]-3-(tritylamino)oxolan-2-yl]methoxy]phosphanyl]-di(propan-2-yl)azanium |
| SMILES | CC(C)[NH+](C(C)C)P(OCCC#N)OCC1OC(n2cnc3c(/N=C\N(C)C)ncnc32)CC1NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H50N9O3P/c1-30(2)50(31(3)4)54(51-24-16-23-42)52-26-36-35(25-37(53-36)49-29-45-38-39(46-28-48(5)6)43-27-44-40(38)49)47-41(32-17-10-7-11-18-32,33-19-12-8-13-20-33)34-21-14-9-15-22-34/h7-15,17-22,27-31,35-37,47H,16,24-26H2,1-6H3/p+1/b46-28- |
| InChIKey | GYBKIQYITQGOTA-UVLLTXLESA-O |
| XLogP | 6.16 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.89 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|