C33H44N6O4Si — CID 159236977
N'-[9-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(1S)-1-ethoxyethoxy]oxolan-2-yl]purin-6-yl]-N,N-dimethylmethanimidamide (PubChem CID 159236977) has the molecular formula C33H44N6O4Si and a molecular weight of 616.84 g/mol. Its IUPAC name is N'-[9-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(1S)-1-ethoxyethoxy]oxolan-2-yl]purin-6-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[9-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(1S)-1-ethoxyethoxy]oxolan-2-yl]purin-6-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 159236977 |
| Molecular Formula | C33H44N6O4Si |
| Molecular Weight | 616.84 g/mol |
| Exact Mass | 616.32 |
| IUPAC Name | N'-[9-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(1S)-1-ethoxyethoxy]oxolan-2-yl]purin-6-yl]-N,N-dimethylmethanimidamide |
| SMILES | CCO[C@H](C)OC1C[C@H](n2cnc3c(N=CN(C)C)ncnc32)O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H44N6O4Si/c1-8-40-24(2)42-27-19-29(39-23-36-30-31(37-22-38(6)7)34-21-35-32(30)39)43-28(27)20-41-44(33(3,4)5,25-15-11-9-12-16-25)26-17-13-10-14-18-26/h9-18,21-24,27-29H,8,19-20H2,1-7H3/t24-,27?,28+,29+/m0/s1 |
| InChIKey | SLIFRWTWQJYMOM-KPRNHTKVSA-N |
| XLogP | 4.68 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.84 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|