C34H45N5O4Si — CID 154619258
N'-[7-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(1-ethoxyethoxy)oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide (PubChem CID 154619258) has the molecular formula C34H45N5O4Si and a molecular weight of 615.85 g/mol. Its IUPAC name is N'-[7-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(1-ethoxyethoxy)oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[7-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(1-ethoxyethoxy)oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 154619258 |
| Molecular Formula | C34H45N5O4Si |
| Molecular Weight | 615.85 g/mol |
| Exact Mass | 615.32 |
| IUPAC Name | N'-[7-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(1-ethoxyethoxy)oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide |
| SMILES | CCOC(C)OC1C[C@H](n2ccc3c(/N=C/N(C)C)ncnc32)O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H45N5O4Si/c1-8-40-25(2)42-29-21-31(39-20-19-28-32(37-24-38(6)7)35-23-36-33(28)39)43-30(29)22-41-44(34(3,4)5,26-15-11-9-12-16-26)27-17-13-10-14-18-27/h9-20,23-25,29-31H,8,21-22H2,1-7H3/b37-24+/t25?,29?,30-,31-/m1/s1 |
| InChIKey | SEKFIXMXMREZDP-GXLHHRDKSA-N |
| XLogP | 5.28 |
| TPSA | 83.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.85 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|