C29H38N6O5 — CID 163968375
N'-[7-[(2R,4S,5R)-4-(2-ethoxypropan-2-yloxy)-5-[(3-methoxy-6,7-dihydroquinolin-7-yl)oxymethyl]oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide (PubChem CID 163968375) has the molecular formula C29H38N6O5 and a molecular weight of 550.66 g/mol. Its IUPAC name is N'-[7-[(2R,4S,5R)-4-(2-ethoxypropan-2-yloxy)-5-[(3-methoxy-6,7-dihydroquinolin-7-yl)oxymethyl]oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[7-[(2R,4S,5R)-4-(2-ethoxypropan-2-yloxy)-5-[(3-methoxy-6,7-dihydroquinolin-7-yl)oxymethyl]oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 163968375 |
| Molecular Formula | C29H38N6O5 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | N'-[7-[(2R,4S,5R)-4-(2-ethoxypropan-2-yloxy)-5-[(3-methoxy-6,7-dihydroquinolin-7-yl)oxymethyl]oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide |
| SMILES | CCOC(C)(C)O[C@H]1C[C@H](n2ccc3c(N=CN(C)C)ncnc32)O[C@@H]1COC1C=c2ncc(OC)cc2=CC1 |
| InChI | InChI=1S/C29H38N6O5/c1-7-38-29(2,3)40-24-14-26(35-11-10-22-27(33-18-34(4)5)31-17-32-28(22)35)39-25(24)16-37-20-9-8-19-12-21(36-6)15-30-23(19)13-20/h8,10-13,15,17-18,20,24-26H,7,9,14,16H2,1-6H3/t20?,24-,25+,26+/m0/s1 |
| InChIKey | SNVCTYBDAREIJV-HEPOIJRFSA-N |
| XLogP | 2.55 |
| TPSA | 105.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|