C28H37ClN6O4 — CID 145263852
N'-[7-[(2R)-5-[(2-chloroquinolin-7-yl)oxymethyl]oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide;ethane;propane-2,2-diol (PubChem CID 145263852) has the molecular formula C28H37ClN6O4 and a molecular weight of 557.10 g/mol. Its IUPAC name is N'-[7-[(2R)-5-[(2-chloroquinolin-7-yl)oxymethyl]oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide;ethane;propane-2,2-diol.
| Compound Name | N'-[7-[(2R)-5-[(2-chloroquinolin-7-yl)oxymethyl]oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide;ethane;propane-2,2-diol |
|---|---|
| PubChem CID | 145263852 |
| Molecular Formula | C28H37ClN6O4 |
| Molecular Weight | 557.10 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | N'-[7-[(2R)-5-[(2-chloroquinolin-7-yl)oxymethyl]oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide;ethane;propane-2,2-diol |
| SMILES | CC.CC(C)(O)O.CN(C)/C=N/c1ncnc2c1ccn2[C@H]1CCC(COc2ccc3ccc(Cl)nc3c2)O1 |
| InChI | InChI=1S/C23H23ClN6O2.C3H8O2.C2H6/c1-29(2)14-27-22-18-9-10-30(23(18)26-13-25-22)21-8-6-17(32-21)12-31-16-5-3-15-4-7-20(24)28-19(15)11-16;1-3(2,4)5;1-2/h3-5,7,9-11,13-14,17,21H,6,8,12H2,1-2H3;4-5H,1-2H3;1-2H3/b27-14+;;/t17?,21-;;/m1../s1 |
| InChIKey | YXZXTYSZWRKNCN-JXRWALAWSA-N |
| XLogP | 5.34 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.10 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|