C24H25BrN6O2 — CID 174096386
N'-[7-[(5S)-5-[(3-bromoquinolin-7-yl)oxymethyl]oxolan-2-yl]-2-methylpyrrolo[2,3-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide (PubChem CID 174096386) has the molecular formula C24H25BrN6O2 and a molecular weight of 509.41 g/mol. Its IUPAC name is N'-[7-[(5S)-5-[(3-bromoquinolin-7-yl)oxymethyl]oxolan-2-yl]-2-methylpyrrolo[2,3-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[7-[(5S)-5-[(3-bromoquinolin-7-yl)oxymethyl]oxolan-2-yl]-2-methylpyrrolo[2,3-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 174096386 |
| Molecular Formula | C24H25BrN6O2 |
| Molecular Weight | 509.41 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | N'-[7-[(5S)-5-[(3-bromoquinolin-7-yl)oxymethyl]oxolan-2-yl]-2-methylpyrrolo[2,3-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide |
| SMILES | Cc1nc(N=CN(C)C)c2ccn(C3CC[C@@H](COc4ccc5cc(Br)cnc5c4)O3)c2n1 |
| InChI | InChI=1S/C24H25BrN6O2/c1-15-28-23(27-14-30(2)3)20-8-9-31(24(20)29-15)22-7-6-19(33-22)13-32-18-5-4-16-10-17(25)12-26-21(16)11-18/h4-5,8-12,14,19,22H,6-7,13H2,1-3H3/t19-,22?/m0/s1 |
| InChIKey | PVRJGCTXSDTPKW-YDNXMHBPSA-N |
| XLogP | 5.03 |
| TPSA | 77.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.41 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|