C33H43N5O4SSi — CID 158676947
N'-[7-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(methylsulfanylmethoxy)oxolan-2-yl]-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-2-yl]-N,N-dimethylmethanimidamide (PubChem CID 158676947) has the molecular formula C33H43N5O4SSi and a molecular weight of 633.89 g/mol. Its IUPAC name is N'-[7-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(methylsulfanylmethoxy)oxolan-2-yl]-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-2-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[7-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(methylsulfanylmethoxy)oxolan-2-yl]-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 158676947 |
| Molecular Formula | C33H43N5O4SSi |
| Molecular Weight | 633.89 g/mol |
| Exact Mass | 633.28 |
| IUPAC Name | N'-[7-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(methylsulfanylmethoxy)oxolan-2-yl]-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-2-yl]-N,N-dimethylmethanimidamide |
| SMILES | CSCOC1C[C@H](n2cc(C)c3c(=O)[nH]c(N=CN(C)C)nc32)O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H43N5O4SSi/c1-23-19-38(30-29(23)31(39)36-32(35-30)34-21-37(5)6)28-18-26(40-22-43-7)27(42-28)20-41-44(33(2,3)4,24-14-10-8-11-15-24)25-16-12-9-13-17-25/h8-17,19,21,26-28H,18,20,22H2,1-7H3,(H,35,36,39)/t26?,27-,28-/m1/s1 |
| InChIKey | CHYRTZGLVQRKQD-DXISBFFWSA-N |
| XLogP | 4.82 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.89 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|