C17H35N2O5P — CID 91587230
2-[[di(propan-2-yl)amino]-(2-ethyl-5-methyloxolan-3-yl)oxyphosphanyl]oxyethyl N-methylcarbamate (PubChem CID 91587230) has the molecular formula C17H35N2O5P and a molecular weight of 378.45 g/mol. Its IUPAC name is 2-[[di(propan-2-yl)amino]-(2-ethyl-5-methyloxolan-3-yl)oxyphosphanyl]oxyethyl N-methylcarbamate.
| Compound Name | 2-[[di(propan-2-yl)amino]-(2-ethyl-5-methyloxolan-3-yl)oxyphosphanyl]oxyethyl N-methylcarbamate |
|---|---|
| PubChem CID | 91587230 |
| Molecular Formula | C17H35N2O5P |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 2-[[di(propan-2-yl)amino]-(2-ethyl-5-methyloxolan-3-yl)oxyphosphanyl]oxyethyl N-methylcarbamate |
| SMILES | CCC1OC(C)CC1OP(OCCOC(=O)NC)N(C(C)C)C(C)C |
| InChI | InChI=1S/C17H35N2O5P/c1-8-15-16(11-14(6)23-15)24-25(19(12(2)3)13(4)5)22-10-9-21-17(20)18-7/h12-16H,8-11H2,1-7H3,(H,18,20) |
| InChIKey | TWAYDXDNTZPCGY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|