C7H13Cl2O2P — CID 58528140
dichloro-[(2R,5S)-2-ethyl-5-methyloxolan-3-yl]oxyphosphane (PubChem CID 58528140) has the molecular formula C7H13Cl2O2P and a molecular weight of 231.06 g/mol. Its IUPAC name is dichloro-[(2R,5S)-2-ethyl-5-methyloxolan-3-yl]oxyphosphane.
| Compound Name | dichloro-[(2R,5S)-2-ethyl-5-methyloxolan-3-yl]oxyphosphane |
|---|---|
| PubChem CID | 58528140 |
| Molecular Formula | C7H13Cl2O2P |
| Molecular Weight | 231.06 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | dichloro-[(2R,5S)-2-ethyl-5-methyloxolan-3-yl]oxyphosphane |
| SMILES | CC[C@H]1O[C@@H](C)CC1OP(Cl)Cl |
| InChI | InChI=1S/C7H13Cl2O2P/c1-3-6-7(11-12(8)9)4-5(2)10-6/h5-7H,3-4H2,1-2H3/t5-,6+,7?/m0/s1 |
| InChIKey | DGFXCSWAQYIVRW-GFCOJPQKSA-N |
| XLogP | 3.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.06 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|