About dichloro-[(2R,5S)-2-ethyl-5-methyloxolan-3-yl]oxyphosphane
dichloro-[(2R,5S)-2-ethyl-5-methyloxolan-3-yl]oxyphosphane (PubChem CID 58528140) has the molecular formula C7H13Cl2O2P
and a molecular weight of 231.06 g/mol. Its IUPAC name is dichloro-[(2R,5S)-2-ethyl-5-methyloxolan-3-yl]oxyphosphane.
Molecular Properties
| Compound Name | dichloro-[(2R,5S)-2-ethyl-5-methyloxolan-3-yl]oxyphosphane |
| PubChem CID | 58528140 |
| Molecular Formula | C7H13Cl2O2P |
| Molecular Weight | 231.06 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | dichloro-[(2R,5S)-2-ethyl-5-methyloxolan-3-yl]oxyphosphane |
| SMILES | CC[C@H]1O[C@@H](C)CC1OP(Cl)Cl |
| InChI | InChI=1S/C7H13Cl2O2P/c1-3-6-7(11-12(8)9)4-5(2)10-6/h5-7H,3-4H2,1-2H3/t5-,6+,7?/m0/s1 |
| InChIKey | DGFXCSWAQYIVRW-GFCOJPQKSA-N |
| XLogP | 3.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.06 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloro-[(2R,5S)-2-ethyl-5-methyloxolan-3-yl]oxyphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro-[(2R,5S)-2-ethyl-5-methyloxolan-3-yl]oxyphosphane?
The IUPAC name of dichloro-[(2R,5S)-2-ethyl-5-methyloxolan-3-yl]oxyphosphane (CID 58528140) is dichloro-[(2R,5S)-2-ethyl-5-methyloxolan-3-yl]oxyphosphane.
What is the SMILES notation for dichloro-[(2R,5S)-2-ethyl-5-methyloxolan-3-yl]oxyphosphane?
The canonical SMILES for dichloro-[(2R,5S)-2-ethyl-5-methyloxolan-3-yl]oxyphosphane is CC[C@H]1O[C@@H](C)CC1OP(Cl)Cl.
What is the InChIKey of dichloro-[(2R,5S)-2-ethyl-5-methyloxolan-3-yl]oxyphosphane?
The InChIKey is DGFXCSWAQYIVRW-GFCOJPQKSA-N. The full InChI is InChI=1S/C7H13Cl2O2P/c1-3-6-7(11-12(8)9)4-5(2)10-6/h5-7H,3-4H2,1-2H3/t5-,6+,7?/m0/s1.
What are the key properties of dichloro-[(2R,5S)-2-ethyl-5-methyloxolan-3-yl]oxyphosphane?
dichloro-[(2R,5S)-2-ethyl-5-methyloxolan-3-yl]oxyphosphane has a molecular weight of 231.06 g/mol, XLogP of 3.66, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro-[(2R,5S)-2-ethyl-5-methyloxolan-3-yl]oxyphosphane is sourced from PubChem (CID 58528140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).