C14H27O7PS — CID 123943498
(2-ethyl-5-sulfanyloxolan-3-yl) (3-methoxy-5-methyloxolan-2-yl)methyl methyl phosphate (PubChem CID 123943498) has the molecular formula C14H27O7PS and a molecular weight of 370.40 g/mol. Its IUPAC name is (2-ethyl-5-sulfanyloxolan-3-yl) (3-methoxy-5-methyloxolan-2-yl)methyl methyl phosphate.
| Compound Name | (2-ethyl-5-sulfanyloxolan-3-yl) (3-methoxy-5-methyloxolan-2-yl)methyl methyl phosphate |
|---|---|
| PubChem CID | 123943498 |
| Molecular Formula | C14H27O7PS |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | (2-ethyl-5-sulfanyloxolan-3-yl) (3-methoxy-5-methyloxolan-2-yl)methyl methyl phosphate |
| SMILES | CCC1OC(S)CC1OP(=O)(OC)OCC1OC(C)CC1OC |
| InChI | InChI=1S/C14H27O7PS/c1-5-10-12(7-14(23)20-10)21-22(15,17-4)18-8-13-11(16-3)6-9(2)19-13/h9-14,23H,5-8H2,1-4H3 |
| InChIKey | PRLRIHRQNFFMPS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|