C25H42N2O12P2 — CID 158467306
(2-ethyl-5-methyloxolan-3-yl) [3-[(3-hydroxy-5-methyloxolan-2-yl)methoxy-(2-isocyanoethoxy)phosphoryl]oxy-5-methyloxolan-2-yl]methyl 2-isocyanoethyl phosphate (PubChem CID 158467306) has the molecular formula C25H42N2O12P2 and a molecular weight of 624.56 g/mol. Its IUPAC name is (2-ethyl-5-methyloxolan-3-yl) [3-[(3-hydroxy-5-methyloxolan-2-yl)methoxy-(2-isocyanoethoxy)phosphoryl]oxy-5-methyloxolan-2-yl]methyl 2-isocyanoethyl phosphate.
| Compound Name | (2-ethyl-5-methyloxolan-3-yl) [3-[(3-hydroxy-5-methyloxolan-2-yl)methoxy-(2-isocyanoethoxy)phosphoryl]oxy-5-methyloxolan-2-yl]methyl 2-isocyanoethyl phosphate |
|---|---|
| PubChem CID | 158467306 |
| Molecular Formula | C25H42N2O12P2 |
| Molecular Weight | 624.56 g/mol |
| Exact Mass | 624.22 |
| IUPAC Name | (2-ethyl-5-methyloxolan-3-yl) [3-[(3-hydroxy-5-methyloxolan-2-yl)methoxy-(2-isocyanoethoxy)phosphoryl]oxy-5-methyloxolan-2-yl]methyl 2-isocyanoethyl phosphate |
| SMILES | [C-]#[N+]CCOP(=O)(OCC1OC(C)CC1OP(=O)(OCC[N+]#[C-])OCC1OC(C)CC1O)OC1CC(C)OC1CC |
| InChI | InChI=1S/C25H42N2O12P2/c1-7-21-22(13-18(3)35-21)38-41(30,32-11-9-27-6)34-16-25-23(14-19(4)37-25)39-40(29,31-10-8-26-5)33-15-24-20(28)12-17(2)36-24/h17-25,28H,7-16H2,1-4H3 |
| InChIKey | HFXLHQNRLIUKFN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 146.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|