C21H35N2O9PS — CID 59109694
[2-[[2-isocyanoethoxy-[2-(methoxymethyl)-5-methyloxolan-3-yl]oxyphosphinothioyl]oxymethyl]-5-methyloxolan-3-yl] 4-(methylamino)-4-oxobutanoate (PubChem CID 59109694) has the molecular formula C21H35N2O9PS and a molecular weight of 522.56 g/mol. Its IUPAC name is [2-[[2-isocyanoethoxy-[2-(methoxymethyl)-5-methyloxolan-3-yl]oxyphosphinothioyl]oxymethyl]-5-methyloxolan-3-yl] 4-(methylamino)-4-oxobutanoate.
| Compound Name | [2-[[2-isocyanoethoxy-[2-(methoxymethyl)-5-methyloxolan-3-yl]oxyphosphinothioyl]oxymethyl]-5-methyloxolan-3-yl] 4-(methylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 59109694 |
| Molecular Formula | C21H35N2O9PS |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | [2-[[2-isocyanoethoxy-[2-(methoxymethyl)-5-methyloxolan-3-yl]oxyphosphinothioyl]oxymethyl]-5-methyloxolan-3-yl] 4-(methylamino)-4-oxobutanoate |
| SMILES | [C-]#[N+]CCOP(=S)(OCC1OC(C)CC1OC(=O)CCC(=O)NC)OC1CC(C)OC1COC |
| InChI | InChI=1S/C21H35N2O9PS/c1-14-10-16(31-21(25)7-6-20(24)23-4)19(30-14)13-28-33(34,27-9-8-22-3)32-17-11-15(2)29-18(17)12-26-5/h14-19H,6-13H2,1-2,4-5H3,(H,23,24) |
| InChIKey | VRYMMBNUIMCOEK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|