C23H34N5O10P — CID 162466626
ethyl 2-[1-[5-(acetyloxymethyl)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]-5,6-dioxo-4H-triazin-4-yl]-2-oxoacetate (PubChem CID 162466626) has the molecular formula C23H34N5O10P and a molecular weight of 571.52 g/mol. Its IUPAC name is ethyl 2-[1-[5-(acetyloxymethyl)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]-5,6-dioxo-4H-triazin-4-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[1-[5-(acetyloxymethyl)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]-5,6-dioxo-4H-triazin-4-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 162466626 |
| Molecular Formula | C23H34N5O10P |
| Molecular Weight | 571.52 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | ethyl 2-[1-[5-(acetyloxymethyl)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyoxolan-2-yl]-5,6-dioxo-4H-triazin-4-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)C1N=NN(C2CC(OP(OCCC#N)N(C(C)C)C(C)C)C(COC(C)=O)O2)C(=O)C1=O |
| InChI | InChI=1S/C23H34N5O10P/c1-7-34-23(33)21(31)19-20(30)22(32)27(26-25-19)18-11-16(17(37-18)12-35-15(6)29)38-39(36-10-8-9-24)28(13(2)3)14(4)5/h13-14,16-19H,7-8,10-12H2,1-6H3 |
| InChIKey | NOQFRMUNHKLWRV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 186.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.52 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|