C20H38BN3O5P2 — CID 158529126
CID 158529126 (PubChem CID 158529126) has the molecular formula C20H38BN3O5P2 and a molecular weight of 473.30 g/mol.
| Compound Name | CID 158529126 |
|---|---|
| PubChem CID | 158529126 |
| Molecular Formula | C20H38BN3O5P2 |
| Molecular Weight | 473.30 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](/C=C/P(C)(C)=O)[C@@H](OP(OCCC#N)N(C(C)C)C(C)C)[C@H]1OCCCN |
| InChI | InChI=1S/C20H38BN3O5P2/c1-15(2)24(16(3)4)30(27-13-8-11-23)29-18-17(9-14-31(5,6)25)28-20(21)19(18)26-12-7-10-22/h9,14-20H,7-8,10,12-13,22H2,1-6H3/b14-9+/t17-,18-,19-,20-,30?/m1/s1 |
| InChIKey | FPFRXAUQRBECAI-OIXHRASTSA-N |
| XLogP | 3.41 |
| TPSA | 107.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|