C19H37BN2O6P2 — CID 154003075
CID 154003075 (PubChem CID 154003075) has the molecular formula C19H37BN2O6P2 and a molecular weight of 462.27 g/mol.
| Compound Name | CID 154003075 |
|---|---|
| PubChem CID | 154003075 |
| Molecular Formula | C19H37BN2O6P2 |
| Molecular Weight | 462.27 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](CCP(=O)(OCC)OCC)CC1OP(OCCC#N)N(C(C)C)C(C)C |
| InChI | InChI=1S/C19H37BN2O6P2/c1-7-25-30(23,26-8-2)13-10-17-14-18(19(20)27-17)28-29(24-12-9-11-21)22(15(3)4)16(5)6/h15-19H,7-10,12-14H2,1-6H3/t17-,18?,19-,29?/m1/s1 |
| InChIKey | UPAZUMSKYWZWCJ-ABRCPDSDSA-N |
| XLogP | 4.59 |
| TPSA | 90.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.27 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|