C17H32BN2O4P — CID 59628408
CID 59628408 (PubChem CID 59628408) has the molecular formula C17H32BN2O4P and a molecular weight of 370.24 g/mol.
| Compound Name | CID 59628408 |
|---|---|
| PubChem CID | 59628408 |
| Molecular Formula | C17H32BN2O4P |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](CC)C(OP(C)N(C(C)C)C(C)C)[C@@H]1OCOCCC#N |
| InChI | InChI=1S/C17H32BN2O4P/c1-7-14-15(24-25(6)20(12(2)3)13(4)5)16(17(18)23-14)22-11-21-10-8-9-19/h12-17H,7-8,10-11H2,1-6H3/t14-,15?,16+,17-,25?/m1/s1 |
| InChIKey | CPWMFKCFNLFJGC-WRSHKCLDSA-N |
| XLogP | 3.01 |
| TPSA | 63.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|