C19H34FN2O4P — CID 158763490
N-[[(1R,2S,4S,6R,7S,8S)-2-deuterio-7-fluoro-8-methyl-9-oxatricyclo[4.3.0.02,4]nonan-6-yl]oxy-(2-isocyanoethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine;tritiooxymethane (PubChem CID 158763490) has the molecular formula C19H34FN2O4P and a molecular weight of 407.48 g/mol. Its IUPAC name is N-[[(1R,2S,4S,6R,7S,8S)-2-deuterio-7-fluoro-8-methyl-9-oxatricyclo[4.3.0.02,4]nonan-6-yl]oxy-(2-isocyanoethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine;tritiooxymethane.
| Compound Name | N-[[(1R,2S,4S,6R,7S,8S)-2-deuterio-7-fluoro-8-methyl-9-oxatricyclo[4.3.0.02,4]nonan-6-yl]oxy-(2-isocyanoethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine;tritiooxymethane |
|---|---|
| PubChem CID | 158763490 |
| Molecular Formula | C19H34FN2O4P |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | N-[[(1R,2S,4S,6R,7S,8S)-2-deuterio-7-fluoro-8-methyl-9-oxatricyclo[4.3.0.02,4]nonan-6-yl]oxy-(2-isocyanoethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine;tritiooxymethane |
| SMILES | [2H][C@]12C[C@H]1C[C@@]1(OP(OCC[N+]#[C-])N(C(C)C)C(C)C)[C@@H]2O[C@@H](C)[C@@H]1F.[3H]OC |
| InChI | InChI=1S/C18H30FN2O3P.CH4O/c1-11(2)21(12(3)4)25(22-8-7-20-6)24-18-10-14-9-15(14)17(18)23-13(5)16(18)19;1-2/h11-17H,7-10H2,1-5H3;2H,1H3/t13-,14-,15-,16-,17+,18-,25?;/m0./s1/i15D;2T |
| InChIKey | IOYSWMGUOJAXLM-PTBRSFIBSA-N |
| XLogP | 3.80 |
| TPSA | 55.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|