C23H36BN2O5P — CID 160595962
CID 160595962 (PubChem CID 160595962) has the molecular formula C23H36BN2O5P and a molecular weight of 462.34 g/mol.
| Compound Name | CID 160595962 |
|---|---|
| PubChem CID | 160595962 |
| Molecular Formula | C23H36BN2O5P |
| Molecular Weight | 462.34 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | — |
| SMILES | [B]C(COC(=O)c1ccccc1)O[C@H](CC)[C@@H](C)OP(OCC[N+]#[C-])N(C(C)C)C(C)C |
| InChI | InChI=1S/C23H36BN2O5P/c1-8-21(30-22(24)16-28-23(27)20-12-10-9-11-13-20)19(6)31-32(29-15-14-25-7)26(17(2)3)18(4)5/h9-13,17-19,21-22H,8,14-16H2,1-6H3/t19-,21-,22?,32?/m1/s1 |
| InChIKey | AZSVKBNCUPJTCV-RSIXHUQGSA-N |
| XLogP | 4.82 |
| TPSA | 61.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.34 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|