C16H27N2O3P — CID 20726650
N-[3-(furan-3-yl)propoxy-(2-isocyanoethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine (PubChem CID 20726650) has the molecular formula C16H27N2O3P and a molecular weight of 326.38 g/mol. Its IUPAC name is N-[3-(furan-3-yl)propoxy-(2-isocyanoethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine.
| Compound Name | N-[3-(furan-3-yl)propoxy-(2-isocyanoethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 20726650 |
| Molecular Formula | C16H27N2O3P |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | N-[3-(furan-3-yl)propoxy-(2-isocyanoethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine |
| SMILES | [C-]#[N+]CCOP(OCCCc1ccoc1)N(C(C)C)C(C)C |
| InChI | InChI=1S/C16H27N2O3P/c1-14(2)18(15(3)4)22(21-12-9-17-5)20-10-6-7-16-8-11-19-13-16/h8,11,13-15H,6-7,9-10,12H2,1-4H3 |
| InChIKey | UNQIVHBKCOGMFW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 39.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|