C38H67N2O3P — CID 140742732
N-[2-isocyanoethoxy-[[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy]phosphanyl]-N-propan-2-ylpropan-2-amine (PubChem CID 140742732) has the molecular formula C38H67N2O3P and a molecular weight of 630.94 g/mol. Its IUPAC name is N-[2-isocyanoethoxy-[[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy]phosphanyl]-N-propan-2-ylpropan-2-amine.
| Compound Name | N-[2-isocyanoethoxy-[[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy]phosphanyl]-N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 140742732 |
| Molecular Formula | C38H67N2O3P |
| Molecular Weight | 630.94 g/mol |
| Exact Mass | 630.49 |
| IUPAC Name | N-[2-isocyanoethoxy-[[(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-6-yl]oxy]phosphanyl]-N-propan-2-ylpropan-2-amine |
| SMILES | [C-]#[N+]CCOP(Oc1c(C)c(C)c2c(c1C)CC[C@@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)O2)N(C(C)C)C(C)C |
| InChI | InChI=1S/C38H67N2O3P/c1-27(2)17-14-18-30(7)19-15-20-31(8)21-16-23-38(12)24-22-35-34(11)36(32(9)33(10)37(35)42-38)43-44(41-26-25-39-13)40(28(3)4)29(5)6/h27-31H,14-26H2,1-12H3/t30-,31-,38-,44?/m1/s1 |
| InChIKey | OUJFYYOGCVOYJX-AZUOTHFXSA-N |
| XLogP | 11.80 |
| TPSA | 35.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.94 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|