C5H11NO2 — CID 91388347
(2R,3R,5S)-2-(aminomethyl)-5-tritiooxolan-3-ol (PubChem CID 91388347) has the molecular formula C5H11NO2 and a molecular weight of 119.16 g/mol. Its IUPAC name is (2R,3R,5S)-2-(aminomethyl)-5-tritiooxolan-3-ol.
| Compound Name | (2R,3R,5S)-2-(aminomethyl)-5-tritiooxolan-3-ol |
|---|---|
| PubChem CID | 91388347 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 119.16 g/mol |
| Exact Mass | 119.09 |
| IUPAC Name | (2R,3R,5S)-2-(aminomethyl)-5-tritiooxolan-3-ol |
| SMILES | [3H][C@H]1C[C@@H](O)[C@@H](CN)O1 |
| InChI | InChI=1S/C5H11NO2/c6-3-5-4(7)1-2-8-5/h4-5,7H,1-3,6H2/t4-,5-/m1/s1/i2T/t2-,4+,5+/m0 |
| InChIKey | HCTHRVVKECQUJT-WVXSJSFTSA-N |
| XLogP | -0.91 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.16 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |