C13H22O4 — CID 135013680
(2R,3S,5S)-2-[(E)-4-[(2S,3S,5S)-2-(hydroxymethyl)-5-tritiooxolan-3-yl]but-2-enyl]-5-tritiooxolan-3-ol (PubChem CID 135013680) has the molecular formula C13H22O4 and a molecular weight of 246.33 g/mol. Its IUPAC name is (2R,3S,5S)-2-[(E)-4-[(2S,3S,5S)-2-(hydroxymethyl)-5-tritiooxolan-3-yl]but-2-enyl]-5-tritiooxolan-3-ol.
| Compound Name | (2R,3S,5S)-2-[(E)-4-[(2S,3S,5S)-2-(hydroxymethyl)-5-tritiooxolan-3-yl]but-2-enyl]-5-tritiooxolan-3-ol |
|---|---|
| PubChem CID | 135013680 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | (2R,3S,5S)-2-[(E)-4-[(2S,3S,5S)-2-(hydroxymethyl)-5-tritiooxolan-3-yl]but-2-enyl]-5-tritiooxolan-3-ol |
| SMILES | [3H][C@H]1C[C@H](C/C=C/C[C@H]2O[C@@H]([3H])C[C@@H]2O)[C@@H](CO)O1 |
| InChI | InChI=1S/C13H22O4/c14-9-13-10(5-7-17-13)3-1-2-4-12-11(15)6-8-16-12/h1-2,10-15H,3-9H2/b2-1+/t10-,11-,12+,13+/m0/s1/i7T,8T/t7-,8-,10-,11-,12+,13+ |
| InChIKey | BECWEBZFIGYZRR-QSFRVBSNSA-N |
| XLogP | 0.87 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|