C10H19BO7P — CID 155627823
CID 155627823 (PubChem CID 155627823) has the molecular formula C10H19BO7P and a molecular weight of 297.06 g/mol.
| Compound Name | CID 155627823 |
|---|---|
| PubChem CID | 155627823 |
| Molecular Formula | C10H19BO7P |
| Molecular Weight | 297.06 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | — |
| SMILES | [3H][C@H]1CC(O)[C@@H](CO[P+]([B-])(O)OC2C[C@H]([3H])O[C@@H]2CO)O1 |
| InChI | InChI=1S/C10H19BO7P/c11-19(14,17-6-10-7(13)1-3-16-10)18-8-2-4-15-9(8)5-12/h7-10,12-14H,1-6H2/t7?,8?,9-,10-,19?/m1/s1/i3T,4T/t3-,4-,7?,8?,9+,10+,19?/m0 |
| InChIKey | JUBNKSYGRUQFJV-IHDRRAQPSA-N |
| XLogP | -0.84 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.06 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|