C8H17O3PS — CID 58974553
hydroxy-[2-[(2R)-3-methoxy-5-tritiooxolan-2-yl]ethyl]-methyl-sulfanylidene-λ5-phosphane (PubChem CID 58974553) has the molecular formula C8H17O3PS and a molecular weight of 226.27 g/mol. Its IUPAC name is hydroxy-[2-[(2R)-3-methoxy-5-tritiooxolan-2-yl]ethyl]-methyl-sulfanylidene-λ5-phosphane.
| Compound Name | hydroxy-[2-[(2R)-3-methoxy-5-tritiooxolan-2-yl]ethyl]-methyl-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 58974553 |
| Molecular Formula | C8H17O3PS |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | hydroxy-[2-[(2R)-3-methoxy-5-tritiooxolan-2-yl]ethyl]-methyl-sulfanylidene-λ5-phosphane |
| SMILES | [3H]C1CC(OC)[C@@H](CCP(C)(O)=S)O1 |
| InChI | InChI=1S/C8H17O3PS/c1-10-7-3-5-11-8(7)4-6-12(2,9)13/h7-8H,3-6H2,1-2H3,(H,9,13)/t7?,8-,12?/m1/s1/i5T/t5?,7?,8-,12? |
| InChIKey | UFDXGTXHOTTZFJ-MCWMGFSTSA-N |
| XLogP | 1.20 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|