C39H48NO11P — CID 154592611
[(2R)-2-[[[3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-ethoxypropoxy]-(2-isocyanoethoxy)phosphanyl]oxymethyl]oxolan-3-yl] 4-oxopentanoate (PubChem CID 154592611) has the molecular formula C39H48NO11P and a molecular weight of 737.78 g/mol. Its IUPAC name is [(2R)-2-[[[3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-ethoxypropoxy]-(2-isocyanoethoxy)phosphanyl]oxymethyl]oxolan-3-yl] 4-oxopentanoate.
| Compound Name | [(2R)-2-[[[3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-ethoxypropoxy]-(2-isocyanoethoxy)phosphanyl]oxymethyl]oxolan-3-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 154592611 |
| Molecular Formula | C39H48NO11P |
| Molecular Weight | 737.78 g/mol |
| Exact Mass | 737.30 |
| IUPAC Name | [(2R)-2-[[[3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-ethoxypropoxy]-(2-isocyanoethoxy)phosphanyl]oxymethyl]oxolan-3-yl] 4-oxopentanoate |
| SMILES | [C-]#[N+]CCOP(OCC(COC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1)OCC)OC[C@H]1OCCC1OC(=O)CCC(C)=O |
| InChI | InChI=1S/C39H48NO11P/c1-6-45-35(27-49-52(48-25-23-40-3)50-28-37-36(22-24-46-37)51-38(42)21-12-29(2)41)26-47-39(30-10-8-7-9-11-30,31-13-17-33(43-4)18-14-31)32-15-19-34(44-5)20-16-32/h7-11,13-20,35-37H,6,12,21-28H2,1-2,4-5H3/t35?,36?,37-,52?/m1/s1 |
| InChIKey | DGUBASSXHPVYHY-RAIRKTBMSA-N |
| XLogP | 6.68 |
| TPSA | 121.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.78 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|