C35H47N2O6P — CID 101112085
[[(2R,3S)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl] propanimidate (PubChem CID 101112085) has the molecular formula C35H47N2O6P and a molecular weight of 622.74 g/mol. Its IUPAC name is [[(2R,3S)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl] propanimidate.
| Compound Name | [[(2R,3S)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl] propanimidate |
|---|---|
| PubChem CID | 101112085 |
| Molecular Formula | C35H47N2O6P |
| Molecular Weight | 622.74 g/mol |
| Exact Mass | 622.32 |
| IUPAC Name | [[(2R,3S)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl] propanimidate |
| SMILES | [H]/N=C(\CC)OP(O[C@H]1CCO[C@@H]1COC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1)N(C(C)C)C(C)C |
| InChI | InChI=1S/C35H47N2O6P/c1-8-34(36)43-44(37(25(2)3)26(4)5)42-32-22-23-40-33(32)24-41-35(27-12-10-9-11-13-27,28-14-18-30(38-6)19-15-28)29-16-20-31(39-7)21-17-29/h9-21,25-26,32-33,36H,8,22-24H2,1-7H3/b36-34+/t32-,33+,44?/m0/s1 |
| InChIKey | WLNLOMZNUDYTAS-AZSYFHOQSA-N |
| XLogP | 7.94 |
| TPSA | 82.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.74 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|