C14H22O4 — CID 122693457
[(1S,3aS,4R,6aS)-4-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl] 5-oxohexanoate (PubChem CID 122693457) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is [(1S,3aS,4R,6aS)-4-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl] 5-oxohexanoate.
| Compound Name | [(1S,3aS,4R,6aS)-4-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl] 5-oxohexanoate |
|---|---|
| PubChem CID | 122693457 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | [(1S,3aS,4R,6aS)-4-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl] 5-oxohexanoate |
| SMILES | CC(=O)CCCC(=O)O[C@H]1CC[C@H]2[C@@H]1CC[C@H]2O |
| InChI | InChI=1S/C14H22O4/c1-9(15)3-2-4-14(17)18-13-8-6-10-11(13)5-7-12(10)16/h10-13,16H,2-8H2,1H3/t10-,11-,12+,13-/m0/s1 |
| InChIKey | XUVZBISGHADQOR-RVMXOQNASA-N |
| XLogP | 1.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |