C21H36O8 — CID 167023934
[(3S,4S,5R)-5,6-di(butanoyloxy)-4-butoxyoxan-3-yl] butanoate (PubChem CID 167023934) has the molecular formula C21H36O8 and a molecular weight of 416.51 g/mol. Its IUPAC name is [(3S,4S,5R)-5,6-di(butanoyloxy)-4-butoxyoxan-3-yl] butanoate.
| Compound Name | [(3S,4S,5R)-5,6-di(butanoyloxy)-4-butoxyoxan-3-yl] butanoate |
|---|---|
| PubChem CID | 167023934 |
| Molecular Formula | C21H36O8 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | [(3S,4S,5R)-5,6-di(butanoyloxy)-4-butoxyoxan-3-yl] butanoate |
| SMILES | CCCCO[C@H]1C(OC(=O)CCC)COC(OC(=O)CCC)[C@@H]1OC(=O)CCC |
| InChI | InChI=1S/C21H36O8/c1-5-9-13-25-19-15(27-16(22)10-6-2)14-26-21(29-18(24)12-8-4)20(19)28-17(23)11-7-3/h15,19-21H,5-14H2,1-4H3/t15?,19-,20+,21?/m0/s1 |
| InChIKey | KTRPHFSBWORENE-AVYCVOBVSA-N |
| XLogP | 3.30 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|