C25H39NO9 — CID 146668167
[(2S,3R,4S,5S)-3,4,5-tri(butanoyloxy)oxan-2-yl] 4-[methyl(prop-2-ynyl)amino]butanoate (PubChem CID 146668167) has the molecular formula C25H39NO9 and a molecular weight of 497.59 g/mol. Its IUPAC name is [(2S,3R,4S,5S)-3,4,5-tri(butanoyloxy)oxan-2-yl] 4-[methyl(prop-2-ynyl)amino]butanoate.
| Compound Name | [(2S,3R,4S,5S)-3,4,5-tri(butanoyloxy)oxan-2-yl] 4-[methyl(prop-2-ynyl)amino]butanoate |
|---|---|
| PubChem CID | 146668167 |
| Molecular Formula | C25H39NO9 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | [(2S,3R,4S,5S)-3,4,5-tri(butanoyloxy)oxan-2-yl] 4-[methyl(prop-2-ynyl)amino]butanoate |
| SMILES | C#CCN(C)CCCC(=O)O[C@@H]1OCC(OC(=O)CCC)[C@H](OC(=O)CCC)[C@H]1OC(=O)CCC |
| InChI | InChI=1S/C25H39NO9/c1-6-11-19(27)32-18-17-31-25(35-22(30)14-10-16-26(5)15-9-4)24(34-21(29)13-8-3)23(18)33-20(28)12-7-2/h4,18,23-25H,6-8,10-17H2,1-3,5H3/t18?,23-,24+,25-/m0/s1 |
| InChIKey | JFAHBLJRHRRPDZ-VLFRXLNASA-N |
| XLogP | 2.37 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|