C25H31NO9 — CID 163893061
[(4S,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl] 3-(1H-indol-3-yl)propanoate (PubChem CID 163893061) has the molecular formula C25H31NO9 and a molecular weight of 489.52 g/mol. Its IUPAC name is [(4S,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl] 3-(1H-indol-3-yl)propanoate.
| Compound Name | [(4S,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl] 3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 163893061 |
| Molecular Formula | C25H31NO9 |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | [(4S,5R)-3,4,5-tri(propanoyloxy)oxan-2-yl] 3-(1H-indol-3-yl)propanoate |
| SMILES | CCC(=O)OC1C(OC(=O)CCc2c[nH]c3ccccc23)OC[C@@H](OC(=O)CC)[C@@H]1OC(=O)CC |
| InChI | InChI=1S/C25H31NO9/c1-4-19(27)32-18-14-31-25(24(34-21(29)6-3)23(18)33-20(28)5-2)35-22(30)12-11-15-13-26-17-10-8-7-9-16(15)17/h7-10,13,18,23-26H,4-6,11-12,14H2,1-3H3/t18-,23+,24?,25?/m1/s1 |
| InChIKey | QDFPQXHJLHBDPE-QWHMOUQSSA-N |
| XLogP | 2.97 |
| TPSA | 130.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|