C22H25NO7 — CID 162466294
[(2S,4S,5R)-4,5-di(propanoyloxy)oxan-2-yl] (E)-3-(1H-indol-3-yl)prop-2-enoate (PubChem CID 162466294) has the molecular formula C22H25NO7 and a molecular weight of 415.44 g/mol. Its IUPAC name is [(2S,4S,5R)-4,5-di(propanoyloxy)oxan-2-yl] (E)-3-(1H-indol-3-yl)prop-2-enoate.
| Compound Name | [(2S,4S,5R)-4,5-di(propanoyloxy)oxan-2-yl] (E)-3-(1H-indol-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 162466294 |
| Molecular Formula | C22H25NO7 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | [(2S,4S,5R)-4,5-di(propanoyloxy)oxan-2-yl] (E)-3-(1H-indol-3-yl)prop-2-enoate |
| SMILES | CCC(=O)O[C@H]1C[C@H](OC(=O)/C=C/c2c[nH]c3ccccc23)OC[C@H]1OC(=O)CC |
| InChI | InChI=1S/C22H25NO7/c1-3-19(24)28-17-11-22(27-13-18(17)29-20(25)4-2)30-21(26)10-9-14-12-23-16-8-6-5-7-15(14)16/h5-10,12,17-18,22-23H,3-4,11,13H2,1-2H3/b10-9+/t17-,18+,22-/m0/s1 |
| InChIKey | BCJKLCYKQDKMGC-MYZOARMXSA-N |
| XLogP | 3.11 |
| TPSA | 103.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|