C24H31NO12 — CID 137357254
5-nitro-2-[(2R,3R,4S,5S)-3,4,5-tri(butanoyloxy)oxan-2-yl]oxybenzoic acid (PubChem CID 137357254) has the molecular formula C24H31NO12 and a molecular weight of 525.51 g/mol. Its IUPAC name is 5-nitro-2-[(2R,3R,4S,5S)-3,4,5-tri(butanoyloxy)oxan-2-yl]oxybenzoic acid.
| Compound Name | 5-nitro-2-[(2R,3R,4S,5S)-3,4,5-tri(butanoyloxy)oxan-2-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 137357254 |
| Molecular Formula | C24H31NO12 |
| Molecular Weight | 525.51 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | 5-nitro-2-[(2R,3R,4S,5S)-3,4,5-tri(butanoyloxy)oxan-2-yl]oxybenzoic acid |
| SMILES | CCCC(=O)OC1CO[C@H](Oc2ccc([N+](=O)[O-])cc2C(=O)O)[C@H](OC(=O)CCC)[C@H]1OC(=O)CCC |
| InChI | InChI=1S/C24H31NO12/c1-4-7-18(26)34-17-13-33-24(35-16-11-10-14(25(31)32)12-15(16)23(29)30)22(37-20(28)9-6-3)21(17)36-19(27)8-5-2/h10-12,17,21-22,24H,4-9,13H2,1-3H3,(H,29,30)/t17?,21-,22+,24+/m0/s1 |
| InChIKey | QZBDIKSMIWVLNZ-DEDGIOOASA-N |
| XLogP | 3.16 |
| TPSA | 177.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|