C17H18O9 — CID 126578301
[(3R,4S,5R)-4,5,6-tri(prop-2-enoyloxy)oxan-3-yl] prop-2-enoate (PubChem CID 126578301) has the molecular formula C17H18O9 and a molecular weight of 366.32 g/mol. Its IUPAC name is [(3R,4S,5R)-4,5,6-tri(prop-2-enoyloxy)oxan-3-yl] prop-2-enoate.
| Compound Name | [(3R,4S,5R)-4,5,6-tri(prop-2-enoyloxy)oxan-3-yl] prop-2-enoate |
|---|---|
| PubChem CID | 126578301 |
| Molecular Formula | C17H18O9 |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | [(3R,4S,5R)-4,5,6-tri(prop-2-enoyloxy)oxan-3-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC1OC[C@@H](OC(=O)C=C)[C@H](OC(=O)C=C)[C@H]1OC(=O)C=C |
| InChI | InChI=1S/C17H18O9/c1-5-11(18)23-10-9-22-17(26-14(21)8-4)16(25-13(20)7-3)15(10)24-12(19)6-2/h5-8,10,15-17H,1-4,9H2/t10-,15+,16-,17?/m1/s1 |
| InChIKey | AQCVAGDHUZOZOR-NLHXFMCVSA-N |
| XLogP | 0.37 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|