C37H52O17 — CID 137428540
[(3R,5R)-2,4,5-tris(5-prop-2-enoyloxypentanoyloxy)oxan-3-yl] 5-(1-hydroxyprop-2-enoxy)pentanoate (PubChem CID 137428540) has the molecular formula C37H52O17 and a molecular weight of 768.81 g/mol. Its IUPAC name is [(3R,5R)-2,4,5-tris(5-prop-2-enoyloxypentanoyloxy)oxan-3-yl] 5-(1-hydroxyprop-2-enoxy)pentanoate.
| Compound Name | [(3R,5R)-2,4,5-tris(5-prop-2-enoyloxypentanoyloxy)oxan-3-yl] 5-(1-hydroxyprop-2-enoxy)pentanoate |
|---|---|
| PubChem CID | 137428540 |
| Molecular Formula | C37H52O17 |
| Molecular Weight | 768.81 g/mol |
| Exact Mass | 768.32 |
| IUPAC Name | [(3R,5R)-2,4,5-tris(5-prop-2-enoyloxypentanoyloxy)oxan-3-yl] 5-(1-hydroxyprop-2-enoxy)pentanoate |
| SMILES | C=CC(=O)OCCCCC(=O)OC1OC[C@@H](OC(=O)CCCCOC(=O)C=C)C(OC(=O)CCCCOC(=O)C=C)[C@H]1OC(=O)CCCCOC(O)C=C |
| InChI | InChI=1S/C37H52O17/c1-5-27(38)46-21-13-9-17-31(42)51-26-25-50-37(54-34(45)20-12-16-24-49-30(41)8-4)36(53-33(44)19-11-15-23-48-29(40)7-3)35(26)52-32(43)18-10-14-22-47-28(39)6-2/h5-8,26,29,35-37,40H,1-4,9-25H2/t26-,29?,35?,36-,37?/m1/s1 |
| InChIKey | PWGBZSSBSYJHBR-TWHPMYFBSA-N |
| XLogP | 3.01 |
| TPSA | 222.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.81 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|