C38H52O16 — CID 118406595
[(1S,2S,3S,4R)-2,3,4-tris(5-prop-2-enoyloxypentanoyloxy)cyclohexyl] 5-prop-2-enoyloxypentanoate (PubChem CID 118406595) has the molecular formula C38H52O16 and a molecular weight of 764.82 g/mol. Its IUPAC name is [(1S,2S,3S,4R)-2,3,4-tris(5-prop-2-enoyloxypentanoyloxy)cyclohexyl] 5-prop-2-enoyloxypentanoate.
| Compound Name | [(1S,2S,3S,4R)-2,3,4-tris(5-prop-2-enoyloxypentanoyloxy)cyclohexyl] 5-prop-2-enoyloxypentanoate |
|---|---|
| PubChem CID | 118406595 |
| Molecular Formula | C38H52O16 |
| Molecular Weight | 764.82 g/mol |
| Exact Mass | 764.33 |
| IUPAC Name | [(1S,2S,3S,4R)-2,3,4-tris(5-prop-2-enoyloxypentanoyloxy)cyclohexyl] 5-prop-2-enoyloxypentanoate |
| SMILES | C=CC(=O)OCCCCC(=O)O[C@@H]1[C@@H](OC(=O)CCCCOC(=O)C=C)[C@H](OC(=O)CCCCOC(=O)C=C)CC[C@@H]1OC(=O)CCCCOC(=O)C=C |
| InChI | InChI=1S/C38H52O16/c1-5-29(39)47-23-13-9-17-33(43)51-27-21-22-28(52-34(44)18-10-14-24-48-30(40)6-2)38(54-36(46)20-12-16-26-50-32(42)8-4)37(27)53-35(45)19-11-15-25-49-31(41)7-3/h5-8,27-28,37-38H,1-4,9-26H2/t27-,28+,37-,38-/m0/s1 |
| InChIKey | CCQLZBRLDZFXHN-BNYWCMEJSA-N |
| XLogP | 4.03 |
| TPSA | 210.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.82 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|