C18H30O8 — CID 151310518
[(2R,3S,4R)-3,4-di(butanoyloxy)-6-hydroxyoxan-2-yl]methyl butanoate (PubChem CID 151310518) has the molecular formula C18H30O8 and a molecular weight of 374.43 g/mol. Its IUPAC name is [(2R,3S,4R)-3,4-di(butanoyloxy)-6-hydroxyoxan-2-yl]methyl butanoate.
| Compound Name | [(2R,3S,4R)-3,4-di(butanoyloxy)-6-hydroxyoxan-2-yl]methyl butanoate |
|---|---|
| PubChem CID | 151310518 |
| Molecular Formula | C18H30O8 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | [(2R,3S,4R)-3,4-di(butanoyloxy)-6-hydroxyoxan-2-yl]methyl butanoate |
| SMILES | CCCC(=O)OC[C@H]1OC(O)C[C@@H](OC(=O)CCC)[C@@H]1OC(=O)CCC |
| InChI | InChI=1S/C18H30O8/c1-4-7-14(19)23-11-13-18(26-16(21)9-6-3)12(10-17(22)25-13)24-15(20)8-5-2/h12-13,17-18,22H,4-11H2,1-3H3/t12-,13-,17?,18+/m1/s1 |
| InChIKey | OEILTUCZIJSMKE-UOGRLHHISA-N |
| XLogP | 1.86 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|