C18H31NO8 — CID 138685206
[(2R,3S,4R,5R)-3-butanoyloxy-5-(2,2,3,3,4,4,4-heptadeuteriobutanoylamino)-4,6-dihydroxyoxan-2-yl]methyl butanoate (PubChem CID 138685206) has the molecular formula C18H31NO8 and a molecular weight of 396.49 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3-butanoyloxy-5-(2,2,3,3,4,4,4-heptadeuteriobutanoylamino)-4,6-dihydroxyoxan-2-yl]methyl butanoate.
| Compound Name | [(2R,3S,4R,5R)-3-butanoyloxy-5-(2,2,3,3,4,4,4-heptadeuteriobutanoylamino)-4,6-dihydroxyoxan-2-yl]methyl butanoate |
|---|---|
| PubChem CID | 138685206 |
| Molecular Formula | C18H31NO8 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | [(2R,3S,4R,5R)-3-butanoyloxy-5-(2,2,3,3,4,4,4-heptadeuteriobutanoylamino)-4,6-dihydroxyoxan-2-yl]methyl butanoate |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)N[C@H]1C(O)O[C@H](COC(=O)CCC)[C@@H](OC(=O)CCC)[C@@H]1O |
| InChI | InChI=1S/C18H31NO8/c1-4-7-12(20)19-15-16(23)17(27-14(22)9-6-3)11(26-18(15)24)10-25-13(21)8-5-2/h11,15-18,23-24H,4-10H2,1-3H3,(H,19,20)/t11-,15-,16-,17-,18?/m1/s1/i1D3,4D2,7D2 |
| InChIKey | DPTRRRAHMDYFGS-LQVRUQDWSA-N |
| XLogP | 0.40 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |