C15H29N3O2S — CID 84556062
tert-butyl N-[2-[(2-methylcyclohexyl)carbamothioylamino]ethyl]carbamate (PubChem CID 84556062) has the molecular formula C15H29N3O2S and a molecular weight of 315.48 g/mol. Its IUPAC name is tert-butyl N-[2-[(2-methylcyclohexyl)carbamothioylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2-methylcyclohexyl)carbamothioylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 84556062 |
| Molecular Formula | C15H29N3O2S |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | tert-butyl N-[2-[(2-methylcyclohexyl)carbamothioylamino]ethyl]carbamate |
| SMILES | CC1CCCCC1NC(=S)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H29N3O2S/c1-11-7-5-6-8-12(11)18-13(21)16-9-10-17-14(19)20-15(2,3)4/h11-12H,5-10H2,1-4H3,(H,17,19)(H2,16,18,21) |
| InChIKey | STKVILHMJANJKX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|