C14H25F3N2O2 — CID 115607086
tert-butyl N-[2-[[2-(trifluoromethyl)cyclohexyl]amino]ethyl]carbamate (PubChem CID 115607086) has the molecular formula C14H25F3N2O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(trifluoromethyl)cyclohexyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(trifluoromethyl)cyclohexyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 115607086 |
| Molecular Formula | C14H25F3N2O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | tert-butyl N-[2-[[2-(trifluoromethyl)cyclohexyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C14H25F3N2O2/c1-13(2,3)21-12(20)19-9-8-18-11-7-5-4-6-10(11)14(15,16)17/h10-11,18H,4-9H2,1-3H3,(H,19,20) |
| InChIKey | KEVITOSGUWIMDM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|