C16H32O4Si — CID 10969136
(1R,2R,3R,4S,5S)-2-methyl-4-tri(propan-2-yl)silyloxy-6,8-dioxabicyclo[3.2.1]octan-3-ol (PubChem CID 10969136) has the molecular formula C16H32O4Si and a molecular weight of 316.51 g/mol. Its IUPAC name is (1R,2R,3R,4S,5S)-2-methyl-4-tri(propan-2-yl)silyloxy-6,8-dioxabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1R,2R,3R,4S,5S)-2-methyl-4-tri(propan-2-yl)silyloxy-6,8-dioxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 10969136 |
| Molecular Formula | C16H32O4Si |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | (1R,2R,3R,4S,5S)-2-methyl-4-tri(propan-2-yl)silyloxy-6,8-dioxabicyclo[3.2.1]octan-3-ol |
| SMILES | CC(C)[Si](O[C@@H]1[C@H]2OC[C@H](O2)[C@H](C)[C@H]1O)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H32O4Si/c1-9(2)21(10(3)4,11(5)6)20-15-14(17)12(7)13-8-18-16(15)19-13/h9-17H,8H2,1-7H3/t12-,13-,14+,15-,16-/m0/s1 |
| InChIKey | YCNNLLRGMBVIEA-QMHWVQJVSA-N |
| XLogP | 3.30 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|