C16H32O5Si — CID 101133967
(5R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,8-trimethyl-1,3,10-trioxaspiro[4.5]decan-8-ol (PubChem CID 101133967) has the molecular formula C16H32O5Si and a molecular weight of 332.51 g/mol. Its IUPAC name is (5R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,8-trimethyl-1,3,10-trioxaspiro[4.5]decan-8-ol.
| Compound Name | (5R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,8-trimethyl-1,3,10-trioxaspiro[4.5]decan-8-ol |
|---|---|
| PubChem CID | 101133967 |
| Molecular Formula | C16H32O5Si |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (5R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,8-trimethyl-1,3,10-trioxaspiro[4.5]decan-8-ol |
| SMILES | CC1(C)OC[C@@]2(C[C@H](O[Si](C)(C)C(C)(C)C)[C@@](C)(O)CO2)O1 |
| InChI | InChI=1S/C16H32O5Si/c1-13(2,3)22(7,8)20-12-9-16(19-10-15(12,6)17)11-18-14(4,5)21-16/h12,17H,9-11H2,1-8H3/t12-,15-,16+/m0/s1 |
| InChIKey | WJWIFHPZAHIKBE-VBNZEHGJSA-N |
| XLogP | 3.03 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|