C22H40O3Si — CID 11291955
[(4aR,6aR,7R,10bR)-3,3,6a,10b-tetramethyl-4a,5,6,7,8,9-hexahydro-1H-naphtho[2,1-d][1,3]dioxin-7-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11291955) has the molecular formula C22H40O3Si and a molecular weight of 380.65 g/mol. Its IUPAC name is [(4aR,6aR,7R,10bR)-3,3,6a,10b-tetramethyl-4a,5,6,7,8,9-hexahydro-1H-naphtho[2,1-d][1,3]dioxin-7-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(4aR,6aR,7R,10bR)-3,3,6a,10b-tetramethyl-4a,5,6,7,8,9-hexahydro-1H-naphtho[2,1-d][1,3]dioxin-7-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11291955 |
| Molecular Formula | C22H40O3Si |
| Molecular Weight | 380.65 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | [(4aR,6aR,7R,10bR)-3,3,6a,10b-tetramethyl-4a,5,6,7,8,9-hexahydro-1H-naphtho[2,1-d][1,3]dioxin-7-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)OC[C@@]2(C)C3=CCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@]3(C)CC[C@H]2O1 |
| InChI | InChI=1S/C22H40O3Si/c1-19(2,3)26(8,9)25-18-12-10-11-16-21(18,6)14-13-17-22(16,7)15-23-20(4,5)24-17/h11,17-18H,10,12-15H2,1-9H3/t17-,18-,21-,22+/m1/s1 |
| InChIKey | DITSHWNMPWHNCM-YHBROIRLSA-N |
| XLogP | 6.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.65 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|