C14H24O4Si — CID 101227252
(7S)-7-[tert-butyl(dimethyl)silyl]oxy-7a-hydroxy-4,5,6,7-tetrahydro-1-benzofuran-2-one (PubChem CID 101227252) has the molecular formula C14H24O4Si and a molecular weight of 284.43 g/mol. Its IUPAC name is (7S)-7-[tert-butyl(dimethyl)silyl]oxy-7a-hydroxy-4,5,6,7-tetrahydro-1-benzofuran-2-one.
| Compound Name | (7S)-7-[tert-butyl(dimethyl)silyl]oxy-7a-hydroxy-4,5,6,7-tetrahydro-1-benzofuran-2-one |
|---|---|
| PubChem CID | 101227252 |
| Molecular Formula | C14H24O4Si |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (7S)-7-[tert-butyl(dimethyl)silyl]oxy-7a-hydroxy-4,5,6,7-tetrahydro-1-benzofuran-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCCC2=CC(=O)OC21O |
| InChI | InChI=1S/C14H24O4Si/c1-13(2,3)19(4,5)18-11-8-6-7-10-9-12(15)17-14(10,11)16/h9,11,16H,6-8H2,1-5H3/t11-,14?/m0/s1 |
| InChIKey | HRDRAEXNPZQTGX-ZSOXZCCMSA-N |
| XLogP | 2.73 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|